C20H28N4O3 — CID 142418233
methoxycyclopentane;3-N-methyl-1-(1-phenylethyl)pyrazole-3,5-dicarboxamide (PubChem CID 142418233) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is methoxycyclopentane;3-N-methyl-1-(1-phenylethyl)pyrazole-3,5-dicarboxamide.
| Compound Name | methoxycyclopentane;3-N-methyl-1-(1-phenylethyl)pyrazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 142418233 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | methoxycyclopentane;3-N-methyl-1-(1-phenylethyl)pyrazole-3,5-dicarboxamide |
| SMILES | CNC(=O)c1cc(C(N)=O)n(C(C)c2ccccc2)n1.COC1CCCC1 |
| InChI | InChI=1S/C14H16N4O2.C6H12O/c1-9(10-6-4-3-5-7-10)18-12(13(15)19)8-11(17-18)14(20)16-2;1-7-6-4-2-3-5-6/h3-9H,1-2H3,(H2,15,19)(H,16,20);6H,2-5H2,1H3 |
| InChIKey | DBJBOYCNEHYLDO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |