C16H17FN2O2 — CID 167321253
cyclobutyl 3-fluoro-1-[(1R)-1-phenylethyl]pyrazole-5-carboxylate (PubChem CID 167321253) has the molecular formula C16H17FN2O2 and a molecular weight of 288.32 g/mol. Its IUPAC name is cyclobutyl 3-fluoro-1-[(1R)-1-phenylethyl]pyrazole-5-carboxylate.
| Compound Name | cyclobutyl 3-fluoro-1-[(1R)-1-phenylethyl]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 167321253 |
| Molecular Formula | C16H17FN2O2 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | cyclobutyl 3-fluoro-1-[(1R)-1-phenylethyl]pyrazole-5-carboxylate |
| SMILES | C[C@H](c1ccccc1)n1nc(F)cc1C(=O)OC1CCC1 |
| InChI | InChI=1S/C16H17FN2O2/c1-11(12-6-3-2-4-7-12)19-14(10-15(17)18-19)16(20)21-13-8-5-9-13/h2-4,6-7,10-11,13H,5,8-9H2,1H3/t11-/m1/s1 |
| InChIKey | KKJGPLOMQAUQFJ-LLVKDONJSA-N |
| XLogP | 3.34 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |