C18H18FN3O3 — CID 167321569
(2-formylcyclohexen-1-yl) 5-fluoro-3-[(1R)-1-phenylethyl]triazole-4-carboxylate (PubChem CID 167321569) has the molecular formula C18H18FN3O3 and a molecular weight of 343.36 g/mol. Its IUPAC name is (2-formylcyclohexen-1-yl) 5-fluoro-3-[(1R)-1-phenylethyl]triazole-4-carboxylate.
| Compound Name | (2-formylcyclohexen-1-yl) 5-fluoro-3-[(1R)-1-phenylethyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 167321569 |
| Molecular Formula | C18H18FN3O3 |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | (2-formylcyclohexen-1-yl) 5-fluoro-3-[(1R)-1-phenylethyl]triazole-4-carboxylate |
| SMILES | C[C@H](c1ccccc1)n1nnc(F)c1C(=O)OC1=C(C=O)CCCC1 |
| InChI | InChI=1S/C18H18FN3O3/c1-12(13-7-3-2-4-8-13)22-16(17(19)20-21-22)18(24)25-15-10-6-5-9-14(15)11-23/h2-4,7-8,11-12H,5-6,9-10H2,1H3/t12-/m1/s1 |
| InChIKey | JPKKCVVKJWRAIX-GFCCVEGCSA-N |
| XLogP | 3.21 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|