C14H16ClN3O2 — CID 167321437
propyl 5-chloro-3-[(1R)-1-phenylethyl]triazole-4-carboxylate (PubChem CID 167321437) has the molecular formula C14H16ClN3O2 and a molecular weight of 293.75 g/mol. Its IUPAC name is propyl 5-chloro-3-[(1R)-1-phenylethyl]triazole-4-carboxylate.
| Compound Name | propyl 5-chloro-3-[(1R)-1-phenylethyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 167321437 |
| Molecular Formula | C14H16ClN3O2 |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | propyl 5-chloro-3-[(1R)-1-phenylethyl]triazole-4-carboxylate |
| SMILES | CCCOC(=O)c1c(Cl)nnn1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C14H16ClN3O2/c1-3-9-20-14(19)12-13(15)16-17-18(12)10(2)11-7-5-4-6-8-11/h4-8,10H,3,9H2,1-2H3/t10-/m1/s1 |
| InChIKey | ARNAVLFXKCLQLF-SNVBAGLBSA-N |
| XLogP | 3.11 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |