C17H21ClN2O2 — CID 155325870
pentan-3-yl 5-chloro-3-[(1R)-1-phenylethyl]imidazole-4-carboxylate (PubChem CID 155325870) has the molecular formula C17H21ClN2O2 and a molecular weight of 320.82 g/mol. Its IUPAC name is pentan-3-yl 5-chloro-3-[(1R)-1-phenylethyl]imidazole-4-carboxylate.
| Compound Name | pentan-3-yl 5-chloro-3-[(1R)-1-phenylethyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 155325870 |
| Molecular Formula | C17H21ClN2O2 |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | pentan-3-yl 5-chloro-3-[(1R)-1-phenylethyl]imidazole-4-carboxylate |
| SMILES | CCC(CC)OC(=O)c1c(Cl)ncn1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C17H21ClN2O2/c1-4-14(5-2)22-17(21)15-16(18)19-11-20(15)12(3)13-9-7-6-8-10-13/h6-12,14H,4-5H2,1-3H3/t12-/m1/s1 |
| InChIKey | DXSPIHGGAGEMSH-GFCCVEGCSA-N |
| XLogP | 4.49 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |