C19H19ClN2O2 — CID 155325868
2-methylhex-5-en-3-yn-2-yl 5-chloro-3-[(1R)-1-phenylethyl]imidazole-4-carboxylate (PubChem CID 155325868) has the molecular formula C19H19ClN2O2 and a molecular weight of 342.83 g/mol. Its IUPAC name is 2-methylhex-5-en-3-yn-2-yl 5-chloro-3-[(1R)-1-phenylethyl]imidazole-4-carboxylate.
| Compound Name | 2-methylhex-5-en-3-yn-2-yl 5-chloro-3-[(1R)-1-phenylethyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 155325868 |
| Molecular Formula | C19H19ClN2O2 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 2-methylhex-5-en-3-yn-2-yl 5-chloro-3-[(1R)-1-phenylethyl]imidazole-4-carboxylate |
| SMILES | C=CC#CC(C)(C)OC(=O)c1c(Cl)ncn1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C19H19ClN2O2/c1-5-6-12-19(3,4)24-18(23)16-17(20)21-13-22(16)14(2)15-10-8-7-9-11-15/h5,7-11,13-14H,1H2,2-4H3/t14-/m1/s1 |
| InChIKey | QGUQPRUBYPHOIF-CQSZACIVSA-N |
| XLogP | 4.27 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|