C17H15ClN2O3 — CID 155325800
(3-ethynyloxetan-3-yl) 5-chloro-3-[(1R)-1-phenylethyl]imidazole-4-carboxylate (PubChem CID 155325800) has the molecular formula C17H15ClN2O3 and a molecular weight of 330.77 g/mol. Its IUPAC name is (3-ethynyloxetan-3-yl) 5-chloro-3-[(1R)-1-phenylethyl]imidazole-4-carboxylate.
| Compound Name | (3-ethynyloxetan-3-yl) 5-chloro-3-[(1R)-1-phenylethyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 155325800 |
| Molecular Formula | C17H15ClN2O3 |
| Molecular Weight | 330.77 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | (3-ethynyloxetan-3-yl) 5-chloro-3-[(1R)-1-phenylethyl]imidazole-4-carboxylate |
| SMILES | C#CC1(OC(=O)c2c(Cl)ncn2[C@H](C)c2ccccc2)COC1 |
| InChI | InChI=1S/C17H15ClN2O3/c1-3-17(9-22-10-17)23-16(21)14-15(18)19-11-20(14)12(2)13-7-5-4-6-8-13/h1,4-8,11-12H,9-10H2,2H3/t12-/m1/s1 |
| InChIKey | ARKUKNOZYDBJAF-GFCCVEGCSA-N |
| XLogP | 2.70 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.77 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|