C16H20ClN3O4 — CID 167321392
1-[5-chloro-3-[(1R)-1-phenylethyl]triazol-4-yl]-2-ethoxy-2,2-dimethoxyethanone (PubChem CID 167321392) has the molecular formula C16H20ClN3O4 and a molecular weight of 353.81 g/mol. Its IUPAC name is 1-[5-chloro-3-[(1R)-1-phenylethyl]triazol-4-yl]-2-ethoxy-2,2-dimethoxyethanone.
| Compound Name | 1-[5-chloro-3-[(1R)-1-phenylethyl]triazol-4-yl]-2-ethoxy-2,2-dimethoxyethanone |
|---|---|
| PubChem CID | 167321392 |
| Molecular Formula | C16H20ClN3O4 |
| Molecular Weight | 353.81 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 1-[5-chloro-3-[(1R)-1-phenylethyl]triazol-4-yl]-2-ethoxy-2,2-dimethoxyethanone |
| SMILES | CCOC(OC)(OC)C(=O)c1c(Cl)nnn1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C16H20ClN3O4/c1-5-24-16(22-3,23-4)14(21)13-15(17)18-19-20(13)11(2)12-9-7-6-8-10-12/h6-11H,5H2,1-4H3/t11-/m1/s1 |
| InChIKey | IQFGHGOGOKQTEE-LLVKDONJSA-N |
| XLogP | 2.71 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.81 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|