C19H25FN2O4 — CID 167321200
2,2,2-triethoxy-1-[4-fluoro-1-[(1R)-1-phenylethyl]pyrazol-5-yl]ethanone (PubChem CID 167321200) has the molecular formula C19H25FN2O4 and a molecular weight of 364.42 g/mol. Its IUPAC name is 2,2,2-triethoxy-1-[4-fluoro-1-[(1R)-1-phenylethyl]pyrazol-5-yl]ethanone.
| Compound Name | 2,2,2-triethoxy-1-[4-fluoro-1-[(1R)-1-phenylethyl]pyrazol-5-yl]ethanone |
|---|---|
| PubChem CID | 167321200 |
| Molecular Formula | C19H25FN2O4 |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 2,2,2-triethoxy-1-[4-fluoro-1-[(1R)-1-phenylethyl]pyrazol-5-yl]ethanone |
| SMILES | CCOC(OCC)(OCC)C(=O)c1c(F)cnn1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C19H25FN2O4/c1-5-24-19(25-6-2,26-7-3)18(23)17-16(20)13-21-22(17)14(4)15-11-9-8-10-12-15/h8-14H,5-7H2,1-4H3/t14-/m1/s1 |
| InChIKey | NRJQROQAJWDKFT-CQSZACIVSA-N |
| XLogP | 3.58 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|