C19H23F2NO4 — CID 167321523
1-[3,4-difluoro-1-[(1R)-1-phenylethyl]pyrrol-2-yl]-2,2-diethoxy-2-methoxyethanone (PubChem CID 167321523) has the molecular formula C19H23F2NO4 and a molecular weight of 367.39 g/mol. Its IUPAC name is 1-[3,4-difluoro-1-[(1R)-1-phenylethyl]pyrrol-2-yl]-2,2-diethoxy-2-methoxyethanone.
| Compound Name | 1-[3,4-difluoro-1-[(1R)-1-phenylethyl]pyrrol-2-yl]-2,2-diethoxy-2-methoxyethanone |
|---|---|
| PubChem CID | 167321523 |
| Molecular Formula | C19H23F2NO4 |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 1-[3,4-difluoro-1-[(1R)-1-phenylethyl]pyrrol-2-yl]-2,2-diethoxy-2-methoxyethanone |
| SMILES | CCOC(OC)(OCC)C(=O)c1c(F)c(F)cn1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C19H23F2NO4/c1-5-25-19(24-4,26-6-2)18(23)17-16(21)15(20)12-22(17)13(3)14-10-8-7-9-11-14/h7-13H,5-6H2,1-4H3/t13-/m1/s1 |
| InChIKey | RAZCCGHNTGZGIN-CYBMUJFWSA-N |
| XLogP | 3.93 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|