About 2-but-2-ynoxy-1-[5-fluoro-3-[(1R)-1-phenylethyl]triazol-4-yl]-2,2-dimethoxyethanone
2-but-2-ynoxy-1-[5-fluoro-3-[(1R)-1-phenylethyl]triazol-4-yl]-2,2-dimethoxyethanone (PubChem CID 167321291) has the molecular formula C18H20FN3O4
and a molecular weight of 361.37 g/mol. Its IUPAC name is 2-but-2-ynoxy-1-[5-fluoro-3-[(1R)-1-phenylethyl]triazol-4-yl]-2,2-dimethoxyethanone.
Molecular Properties
| Compound Name | 2-but-2-ynoxy-1-[5-fluoro-3-[(1R)-1-phenylethyl]triazol-4-yl]-2,2-dimethoxyethanone |
| PubChem CID | 167321291 |
| Molecular Formula | C18H20FN3O4 |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 2-but-2-ynoxy-1-[5-fluoro-3-[(1R)-1-phenylethyl]triazol-4-yl]-2,2-dimethoxyethanone |
| SMILES | CC#CCOC(OC)(OC)C(=O)c1c(F)nnn1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C18H20FN3O4/c1-5-6-12-26-18(24-3,25-4)16(23)15-17(19)20-21-22(15)13(2)14-10-8-7-9-11-14/h7-11,13H,12H2,1-4H3/t13-/m1/s1 |
| InChIKey | XEEJELXKWDPNSP-CYBMUJFWSA-N |
| XLogP | 2.20 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-but-2-ynoxy-1-[5-fluoro-3-[(1R)-1-phenylethyl]triazol-4-yl]-2,2-dimethoxyethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-but-2-ynoxy-1-[5-fluoro-3-[(1R)-1-phenylethyl]triazol-4-yl]-2,2-dimethoxyethanone?
The IUPAC name of 2-but-2-ynoxy-1-[5-fluoro-3-[(1R)-1-phenylethyl]triazol-4-yl]-2,2-dimethoxyethanone (CID 167321291) is 2-but-2-ynoxy-1-[5-fluoro-3-[(1R)-1-phenylethyl]triazol-4-yl]-2,2-dimethoxyethanone.
What is the SMILES notation for 2-but-2-ynoxy-1-[5-fluoro-3-[(1R)-1-phenylethyl]triazol-4-yl]-2,2-dimethoxyethanone?
The canonical SMILES for 2-but-2-ynoxy-1-[5-fluoro-3-[(1R)-1-phenylethyl]triazol-4-yl]-2,2-dimethoxyethanone is CC#CCOC(OC)(OC)C(=O)c1c(F)nnn1[C@H](C)c1ccccc1.
What is the InChIKey of 2-but-2-ynoxy-1-[5-fluoro-3-[(1R)-1-phenylethyl]triazol-4-yl]-2,2-dimethoxyethanone?
The InChIKey is XEEJELXKWDPNSP-CYBMUJFWSA-N. The full InChI is InChI=1S/C18H20FN3O4/c1-5-6-12-26-18(24-3,25-4)16(23)15-17(19)20-21-22(15)13(2)14-10-8-7-9-11-14/h7-11,13H,12H2,1-4H3/t13-/m1/s1.
What are the key properties of 2-but-2-ynoxy-1-[5-fluoro-3-[(1R)-1-phenylethyl]triazol-4-yl]-2,2-dimethoxyethanone?
2-but-2-ynoxy-1-[5-fluoro-3-[(1R)-1-phenylethyl]triazol-4-yl]-2,2-dimethoxyethanone has a molecular weight of 361.37 g/mol, XLogP of 2.20, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-but-2-ynoxy-1-[5-fluoro-3-[(1R)-1-phenylethyl]triazol-4-yl]-2,2-dimethoxyethanone is sourced from PubChem (CID 167321291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).