C16H18FN3O2S — CID 167321365
S-[(3-methyloxetan-3-yl)methyl] 5-fluoro-3-[(1R)-1-phenylethyl]triazole-4-carbothioate (PubChem CID 167321365) has the molecular formula C16H18FN3O2S and a molecular weight of 335.40 g/mol. Its IUPAC name is S-[(3-methyloxetan-3-yl)methyl] 5-fluoro-3-[(1R)-1-phenylethyl]triazole-4-carbothioate.
| Compound Name | S-[(3-methyloxetan-3-yl)methyl] 5-fluoro-3-[(1R)-1-phenylethyl]triazole-4-carbothioate |
|---|---|
| PubChem CID | 167321365 |
| Molecular Formula | C16H18FN3O2S |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | S-[(3-methyloxetan-3-yl)methyl] 5-fluoro-3-[(1R)-1-phenylethyl]triazole-4-carbothioate |
| SMILES | C[C@H](c1ccccc1)n1nnc(F)c1C(=O)SCC1(C)COC1 |
| InChI | InChI=1S/C16H18FN3O2S/c1-11(12-6-4-3-5-7-12)20-13(14(17)18-19-20)15(21)23-10-16(2)8-22-9-16/h3-7,11H,8-10H2,1-2H3/t11-/m1/s1 |
| InChIKey | PYQJZHNQDRNJGV-LLVKDONJSA-N |
| XLogP | 2.94 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|