C18H20FN3O3 — CID 167321550
(2-oxocyclohexyl)methyl 5-fluoro-3-[(1R)-1-phenylethyl]triazole-4-carboxylate (PubChem CID 167321550) has the molecular formula C18H20FN3O3 and a molecular weight of 345.37 g/mol. Its IUPAC name is (2-oxocyclohexyl)methyl 5-fluoro-3-[(1R)-1-phenylethyl]triazole-4-carboxylate.
| Compound Name | (2-oxocyclohexyl)methyl 5-fluoro-3-[(1R)-1-phenylethyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 167321550 |
| Molecular Formula | C18H20FN3O3 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | (2-oxocyclohexyl)methyl 5-fluoro-3-[(1R)-1-phenylethyl]triazole-4-carboxylate |
| SMILES | C[C@H](c1ccccc1)n1nnc(F)c1C(=O)OCC1CCCCC1=O |
| InChI | InChI=1S/C18H20FN3O3/c1-12(13-7-3-2-4-8-13)22-16(17(19)20-21-22)18(24)25-11-14-9-5-6-10-15(14)23/h2-4,7-8,12,14H,5-6,9-11H2,1H3/t12-,14?/m1/s1 |
| InChIKey | HHFYHOUFRVILQH-PUODRLBUSA-N |
| XLogP | 2.94 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |