C15H17N3O2 — CID 167321480
cyclopropylmethyl 3-[(1R)-1-phenylethyl]triazole-4-carboxylate (PubChem CID 167321480) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is cyclopropylmethyl 3-[(1R)-1-phenylethyl]triazole-4-carboxylate.
| Compound Name | cyclopropylmethyl 3-[(1R)-1-phenylethyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 167321480 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | cyclopropylmethyl 3-[(1R)-1-phenylethyl]triazole-4-carboxylate |
| SMILES | C[C@H](c1ccccc1)n1nncc1C(=O)OCC1CC1 |
| InChI | InChI=1S/C15H17N3O2/c1-11(13-5-3-2-4-6-13)18-14(9-16-17-18)15(19)20-10-12-7-8-12/h2-6,9,11-12H,7-8,10H2,1H3/t11-/m1/s1 |
| InChIKey | KCINPBGLDMLPTA-LLVKDONJSA-N |
| XLogP | 2.45 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |