C22H28N2O4 — CID 118246228
[3-(cyclohexylmethoxy)-3-oxopropyl] 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate (PubChem CID 118246228) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is [3-(cyclohexylmethoxy)-3-oxopropyl] 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate.
| Compound Name | [3-(cyclohexylmethoxy)-3-oxopropyl] 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 118246228 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | [3-(cyclohexylmethoxy)-3-oxopropyl] 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate |
| SMILES | C[C@H](c1ccccc1)n1cncc1C(=O)OCCC(=O)OCC1CCCCC1 |
| InChI | InChI=1S/C22H28N2O4/c1-17(19-10-6-3-7-11-19)24-16-23-14-20(24)22(26)27-13-12-21(25)28-15-18-8-4-2-5-9-18/h3,6-7,10-11,14,16-18H,2,4-5,8-9,12-13,15H2,1H3/t17-/m1/s1 |
| InChIKey | ZKCRZJZLQYBNAK-QGZVFWFLSA-N |
| XLogP | 4.16 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |