C17H23N3O4 — CID 167321581
2,2-dimethoxy-1-[3-[(1R)-1-phenylethyl]triazol-4-yl]-2-propan-2-yloxyethanone (PubChem CID 167321581) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is 2,2-dimethoxy-1-[3-[(1R)-1-phenylethyl]triazol-4-yl]-2-propan-2-yloxyethanone.
| Compound Name | 2,2-dimethoxy-1-[3-[(1R)-1-phenylethyl]triazol-4-yl]-2-propan-2-yloxyethanone |
|---|---|
| PubChem CID | 167321581 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 2,2-dimethoxy-1-[3-[(1R)-1-phenylethyl]triazol-4-yl]-2-propan-2-yloxyethanone |
| SMILES | COC(OC)(OC(C)C)C(=O)c1cnnn1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C17H23N3O4/c1-12(2)24-17(22-4,23-5)16(21)15-11-18-19-20(15)13(3)14-9-7-6-8-10-14/h6-13H,1-5H3/t13-/m1/s1 |
| InChIKey | OLOJKWRSDQQZPO-CYBMUJFWSA-N |
| XLogP | 2.44 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|