About (3-methyloxetan-3-yl) 3-[(1R)-1-phenylethyl]triazole-4-carboxylate
(3-methyloxetan-3-yl) 3-[(1R)-1-phenylethyl]triazole-4-carboxylate (PubChem CID 167321512) has the molecular formula C15H17N3O3
and a molecular weight of 287.32 g/mol. Its IUPAC name is (3-methyloxetan-3-yl) 3-[(1R)-1-phenylethyl]triazole-4-carboxylate.
Molecular Properties
| Compound Name | (3-methyloxetan-3-yl) 3-[(1R)-1-phenylethyl]triazole-4-carboxylate |
| PubChem CID | 167321512 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | (3-methyloxetan-3-yl) 3-[(1R)-1-phenylethyl]triazole-4-carboxylate |
| SMILES | C[C@H](c1ccccc1)n1nncc1C(=O)OC1(C)COC1 |
| InChI | InChI=1S/C15H17N3O3/c1-11(12-6-4-3-5-7-12)18-13(8-16-17-18)14(19)21-15(2)9-20-10-15/h3-8,11H,9-10H2,1-2H3/t11-/m1/s1 |
| InChIKey | GWVWJAALPYFUIM-LLVKDONJSA-N |
| XLogP | 1.83 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3-methyloxetan-3-yl) 3-[(1R)-1-phenylethyl]triazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyloxetan-3-yl) 3-[(1R)-1-phenylethyl]triazole-4-carboxylate?
The IUPAC name of (3-methyloxetan-3-yl) 3-[(1R)-1-phenylethyl]triazole-4-carboxylate (CID 167321512) is (3-methyloxetan-3-yl) 3-[(1R)-1-phenylethyl]triazole-4-carboxylate.
What is the SMILES notation for (3-methyloxetan-3-yl) 3-[(1R)-1-phenylethyl]triazole-4-carboxylate?
The canonical SMILES for (3-methyloxetan-3-yl) 3-[(1R)-1-phenylethyl]triazole-4-carboxylate is C[C@H](c1ccccc1)n1nncc1C(=O)OC1(C)COC1.
What is the InChIKey of (3-methyloxetan-3-yl) 3-[(1R)-1-phenylethyl]triazole-4-carboxylate?
The InChIKey is GWVWJAALPYFUIM-LLVKDONJSA-N. The full InChI is InChI=1S/C15H17N3O3/c1-11(12-6-4-3-5-7-12)18-13(8-16-17-18)14(19)21-15(2)9-20-10-15/h3-8,11H,9-10H2,1-2H3/t11-/m1/s1.
What are the key properties of (3-methyloxetan-3-yl) 3-[(1R)-1-phenylethyl]triazole-4-carboxylate?
(3-methyloxetan-3-yl) 3-[(1R)-1-phenylethyl]triazole-4-carboxylate has a molecular weight of 287.32 g/mol, XLogP of 1.83, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyloxetan-3-yl) 3-[(1R)-1-phenylethyl]triazole-4-carboxylate is sourced from PubChem (CID 167321512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).