C16H19N3O2 — CID 167321614
pent-1-en-3-yl 3-[(1R)-1-phenylethyl]triazole-4-carboxylate (PubChem CID 167321614) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is pent-1-en-3-yl 3-[(1R)-1-phenylethyl]triazole-4-carboxylate.
| Compound Name | pent-1-en-3-yl 3-[(1R)-1-phenylethyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 167321614 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | pent-1-en-3-yl 3-[(1R)-1-phenylethyl]triazole-4-carboxylate |
| SMILES | C=CC(CC)OC(=O)c1cnnn1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C16H19N3O2/c1-4-14(5-2)21-16(20)15-11-17-18-19(15)12(3)13-9-7-6-8-10-13/h4,6-12,14H,1,5H2,2-3H3/t12-,14?/m1/s1 |
| InChIKey | NYGDMTSXVSHQKK-PUODRLBUSA-N |
| XLogP | 3.01 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|