C15H15FN2O2S — CID 167321596
thietan-3-yl 4-fluoro-1-[(1R)-1-phenylethyl]pyrazole-5-carboxylate (PubChem CID 167321596) has the molecular formula C15H15FN2O2S and a molecular weight of 306.36 g/mol. Its IUPAC name is thietan-3-yl 4-fluoro-1-[(1R)-1-phenylethyl]pyrazole-5-carboxylate.
| Compound Name | thietan-3-yl 4-fluoro-1-[(1R)-1-phenylethyl]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 167321596 |
| Molecular Formula | C15H15FN2O2S |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | thietan-3-yl 4-fluoro-1-[(1R)-1-phenylethyl]pyrazole-5-carboxylate |
| SMILES | C[C@H](c1ccccc1)n1ncc(F)c1C(=O)OC1CSC1 |
| InChI | InChI=1S/C15H15FN2O2S/c1-10(11-5-3-2-4-6-11)18-14(13(16)7-17-18)15(19)20-12-8-21-9-12/h2-7,10,12H,8-9H2,1H3/t10-/m1/s1 |
| InChIKey | SMNNFIKVYZQUNL-SNVBAGLBSA-N |
| XLogP | 2.90 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |