C20H21ClN2O4 — CID 167321286
(2-methoxycarbonylcyclohexen-1-yl) 4-chloro-1-[(1R)-1-phenylethyl]pyrazole-5-carboxylate (PubChem CID 167321286) has the molecular formula C20H21ClN2O4 and a molecular weight of 388.85 g/mol. Its IUPAC name is (2-methoxycarbonylcyclohexen-1-yl) 4-chloro-1-[(1R)-1-phenylethyl]pyrazole-5-carboxylate.
| Compound Name | (2-methoxycarbonylcyclohexen-1-yl) 4-chloro-1-[(1R)-1-phenylethyl]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 167321286 |
| Molecular Formula | C20H21ClN2O4 |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | (2-methoxycarbonylcyclohexen-1-yl) 4-chloro-1-[(1R)-1-phenylethyl]pyrazole-5-carboxylate |
| SMILES | COC(=O)C1=C(OC(=O)c2c(Cl)cnn2[C@H](C)c2ccccc2)CCCC1 |
| InChI | InChI=1S/C20H21ClN2O4/c1-13(14-8-4-3-5-9-14)23-18(16(21)12-22-23)20(25)27-17-11-7-6-10-15(17)19(24)26-2/h3-5,8-9,12-13H,6-7,10-11H2,1-2H3/t13-/m1/s1 |
| InChIKey | JVLHJRLACSDLLD-CYBMUJFWSA-N |
| XLogP | 4.30 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |