C24H24FNO6S — CID 135319019
2-O-benzyl 3-O-methyl (3S,3aR,6aS)-5-(4-fluorophenoxy)carbothioyloxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2,3-dicarboxylate (PubChem CID 135319019) has the molecular formula C24H24FNO6S and a molecular weight of 473.52 g/mol. Its IUPAC name is 2-O-benzyl 3-O-methyl (3S,3aR,6aS)-5-(4-fluorophenoxy)carbothioyloxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2,3-dicarboxylate.
| Compound Name | 2-O-benzyl 3-O-methyl (3S,3aR,6aS)-5-(4-fluorophenoxy)carbothioyloxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 135319019 |
| Molecular Formula | C24H24FNO6S |
| Molecular Weight | 473.52 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | 2-O-benzyl 3-O-methyl (3S,3aR,6aS)-5-(4-fluorophenoxy)carbothioyloxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2,3-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]2CC(OC(=S)Oc3ccc(F)cc3)C[C@@H]2CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H24FNO6S/c1-29-22(27)21-20-12-19(32-24(33)31-18-9-7-17(25)8-10-18)11-16(20)13-26(21)23(28)30-14-15-5-3-2-4-6-15/h2-10,16,19-21H,11-14H2,1H3/t16-,19?,20-,21+/m1/s1 |
| InChIKey | JXTIIZSMMDDWOX-ZNDGOPKYSA-N |
| XLogP | 4.09 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|