C7H7F3N2O4S2 — CID 135320022
1,1-difluoro-N'-(4-fluorophenyl)methanedisulfonamide (PubChem CID 135320022) has the molecular formula C7H7F3N2O4S2 and a molecular weight of 304.27 g/mol. Its IUPAC name is 1,1-difluoro-N'-(4-fluorophenyl)methanedisulfonamide.
| Compound Name | 1,1-difluoro-N'-(4-fluorophenyl)methanedisulfonamide |
|---|---|
| PubChem CID | 135320022 |
| Molecular Formula | C7H7F3N2O4S2 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 303.98 |
| IUPAC Name | 1,1-difluoro-N'-(4-fluorophenyl)methanedisulfonamide |
| SMILES | NS(=O)(=O)C(F)(F)S(=O)(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C7H7F3N2O4S2/c8-5-1-3-6(4-2-5)12-18(15,16)7(9,10)17(11,13)14/h1-4,12H,(H2,11,13,14) |
| InChIKey | FFEWZZHMXDVXFD-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |