C22H20FNO4 — CID 135320414
2-[3-[2-(4-fluorophenoxy)ethoxy]phenyl]-N-hydroxy-2-phenylacetamide (PubChem CID 135320414) has the molecular formula C22H20FNO4 and a molecular weight of 381.40 g/mol. Its IUPAC name is 2-[3-[2-(4-fluorophenoxy)ethoxy]phenyl]-N-hydroxy-2-phenylacetamide.
| Compound Name | 2-[3-[2-(4-fluorophenoxy)ethoxy]phenyl]-N-hydroxy-2-phenylacetamide |
|---|---|
| PubChem CID | 135320414 |
| Molecular Formula | C22H20FNO4 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 2-[3-[2-(4-fluorophenoxy)ethoxy]phenyl]-N-hydroxy-2-phenylacetamide |
| SMILES | O=C(NO)C(c1ccccc1)c1cccc(OCCOc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C22H20FNO4/c23-18-9-11-19(12-10-18)27-13-14-28-20-8-4-7-17(15-20)21(22(25)24-26)16-5-2-1-3-6-16/h1-12,15,21,26H,13-14H2,(H,24,25) |
| InChIKey | DUUDDDDWJNPHLU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|