C16H27N3O5S2 — CID 135323560
[2-[[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]methyl]-1,3-thiazol-5-yl] ethanesulfonate (PubChem CID 135323560) has the molecular formula C16H27N3O5S2 and a molecular weight of 405.54 g/mol. Its IUPAC name is [2-[[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]methyl]-1,3-thiazol-5-yl] ethanesulfonate.
| Compound Name | [2-[[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]methyl]-1,3-thiazol-5-yl] ethanesulfonate |
|---|---|
| PubChem CID | 135323560 |
| Molecular Formula | C16H27N3O5S2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | [2-[[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]methyl]-1,3-thiazol-5-yl] ethanesulfonate |
| SMILES | CCS(=O)(=O)Oc1cnc(CN2CCC(NC(=O)OC(C)(C)C)CC2)s1 |
| InChI | InChI=1S/C16H27N3O5S2/c1-5-26(21,22)24-14-10-17-13(25-14)11-19-8-6-12(7-9-19)18-15(20)23-16(2,3)4/h10,12H,5-9,11H2,1-4H3,(H,18,20) |
| InChIKey | LHSCZOLYZBLMJE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|