About 2'-(azidomethyl)spiro[1H-indole-3,4'-oxolane]-2-one
2'-(azidomethyl)spiro[1H-indole-3,4'-oxolane]-2-one (PubChem CID 135325163) has the molecular formula C12H12N4O2
and a molecular weight of 244.25 g/mol. Its IUPAC name is 2'-(azidomethyl)spiro[1H-indole-3,4'-oxolane]-2-one.
Molecular Properties
| Compound Name | 2'-(azidomethyl)spiro[1H-indole-3,4'-oxolane]-2-one |
| PubChem CID | 135325163 |
| Molecular Formula | C12H12N4O2 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 2'-(azidomethyl)spiro[1H-indole-3,4'-oxolane]-2-one |
| SMILES | [N-]=[N+]=NCC1CC2(CO1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C12H12N4O2/c13-16-14-6-8-5-12(7-18-8)9-3-1-2-4-10(9)15-11(12)17/h1-4,8H,5-7H2,(H,15,17) |
| InChIKey | LCPXMBBWHPULJZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2'-(azidomethyl)spiro[1H-indole-3,4'-oxolane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2'-(azidomethyl)spiro[1H-indole-3,4'-oxolane]-2-one?
The IUPAC name of 2'-(azidomethyl)spiro[1H-indole-3,4'-oxolane]-2-one (CID 135325163) is 2'-(azidomethyl)spiro[1H-indole-3,4'-oxolane]-2-one.
What is the SMILES notation for 2'-(azidomethyl)spiro[1H-indole-3,4'-oxolane]-2-one?
The canonical SMILES for 2'-(azidomethyl)spiro[1H-indole-3,4'-oxolane]-2-one is [N-]=[N+]=NCC1CC2(CO1)C(=O)Nc1ccccc12.
What is the InChIKey of 2'-(azidomethyl)spiro[1H-indole-3,4'-oxolane]-2-one?
The InChIKey is LCPXMBBWHPULJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4O2/c13-16-14-6-8-5-12(7-18-8)9-3-1-2-4-10(9)15-11(12)17/h1-4,8H,5-7H2,(H,15,17).
What are the key properties of 2'-(azidomethyl)spiro[1H-indole-3,4'-oxolane]-2-one?
2'-(azidomethyl)spiro[1H-indole-3,4'-oxolane]-2-one has a molecular weight of 244.25 g/mol, XLogP of 1.98, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2'-(azidomethyl)spiro[1H-indole-3,4'-oxolane]-2-one is sourced from PubChem (CID 135325163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).