C7H20O20P6 — CID 135325464
2-(1,1,2,2,2-pentaphosphonoethyl)-2-phosphonopentanoic acid (PubChem CID 135325464) has the molecular formula C7H20O20P6 and a molecular weight of 610.06 g/mol. Its IUPAC name is 2-(1,1,2,2,2-pentaphosphonoethyl)-2-phosphonopentanoic acid.
| Compound Name | 2-(1,1,2,2,2-pentaphosphonoethyl)-2-phosphonopentanoic acid |
|---|---|
| PubChem CID | 135325464 |
| Molecular Formula | C7H20O20P6 |
| Molecular Weight | 610.06 g/mol |
| Exact Mass | 609.90 |
| IUPAC Name | 2-(1,1,2,2,2-pentaphosphonoethyl)-2-phosphonopentanoic acid |
| SMILES | CCCC(C(=O)O)(C(C(P(=O)(O)O)(P(=O)(O)O)P(=O)(O)O)(P(=O)(O)O)P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C7H20O20P6/c1-2-3-5(4(8)9,28(10,11)12)6(29(13,14)15,30(16,17)18)7(31(19,20)21,32(22,23)24)33(25,26)27/h2-3H2,1H3,(H,8,9)(H2,10,11,12)(H2,13,14,15)(H2,16,17,18)(H2,19,20,21)(H2,22,23,24)(H2,25,26,27) |
| InChIKey | KOYGLPBUZJWMPN-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 382.48 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.06 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|