C6H14NO5P — CID 88816768
[1-amino-2-(hydroxymethyl)-1-oxopentan-2-yl]phosphonic acid (PubChem CID 88816768) has the molecular formula C6H14NO5P and a molecular weight of 211.15 g/mol. Its IUPAC name is [1-amino-2-(hydroxymethyl)-1-oxopentan-2-yl]phosphonic acid.
| Compound Name | [1-amino-2-(hydroxymethyl)-1-oxopentan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 88816768 |
| Molecular Formula | C6H14NO5P |
| Molecular Weight | 211.15 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | [1-amino-2-(hydroxymethyl)-1-oxopentan-2-yl]phosphonic acid |
| SMILES | CCCC(CO)(C(N)=O)P(=O)(O)O |
| InChI | InChI=1S/C6H14NO5P/c1-2-3-6(4-8,5(7)9)13(10,11)12/h8H,2-4H2,1H3,(H2,7,9)(H2,10,11,12) |
| InChIKey | PTWICQTXRWBMNH-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.15 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|