C6H13NO5S — CID 174457152
1-amino-2-(hydroxymethyl)-1-oxopentane-2-sulfonic acid (PubChem CID 174457152) has the molecular formula C6H13NO5S and a molecular weight of 211.24 g/mol. Its IUPAC name is 1-amino-2-(hydroxymethyl)-1-oxopentane-2-sulfonic acid.
| Compound Name | 1-amino-2-(hydroxymethyl)-1-oxopentane-2-sulfonic acid |
|---|---|
| PubChem CID | 174457152 |
| Molecular Formula | C6H13NO5S |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | 1-amino-2-(hydroxymethyl)-1-oxopentane-2-sulfonic acid |
| SMILES | CCCC(CO)(C(N)=O)S(=O)(=O)O |
| InChI | InChI=1S/C6H13NO5S/c1-2-3-6(4-8,5(7)9)13(10,11)12/h8H,2-4H2,1H3,(H2,7,9)(H,10,11,12) |
| InChIKey | DFBFEXZGONBXBD-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|