C4H10NaO5S — CID 170307340
CID 170307340 (PubChem CID 170307340) has the molecular formula C4H10NaO5S and a molecular weight of 193.18 g/mol.
| Compound Name | CID 170307340 |
|---|---|
| PubChem CID | 170307340 |
| Molecular Formula | C4H10NaO5S |
| Molecular Weight | 193.18 g/mol |
| Exact Mass | 193.01 |
| IUPAC Name | — |
| SMILES | CCCC(O)(O)S(=O)(=O)O.[Na] |
| InChI | InChI=1S/C4H10O5S.Na/c1-2-3-4(5,6)10(7,8)9;/h5-6H,2-3H2,1H3,(H,7,8,9); |
| InChIKey | VYTMKOYZNFVRLE-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.18 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|