C6H8F6O5S2 — CID 21467863
1,1-bis(trifluoromethylsulfonyl)butan-1-ol (PubChem CID 21467863) has the molecular formula C6H8F6O5S2 and a molecular weight of 338.25 g/mol. Its IUPAC name is 1,1-bis(trifluoromethylsulfonyl)butan-1-ol.
| Compound Name | 1,1-bis(trifluoromethylsulfonyl)butan-1-ol |
|---|---|
| PubChem CID | 21467863 |
| Molecular Formula | C6H8F6O5S2 |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 337.97 |
| IUPAC Name | 1,1-bis(trifluoromethylsulfonyl)butan-1-ol |
| SMILES | CCCC(O)(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C6H8F6O5S2/c1-2-3-4(13,18(14,15)5(7,8)9)19(16,17)6(10,11)12/h13H,2-3H2,1H3 |
| InChIKey | MRCCORNUQNQVID-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |