C5H7Br5O2S — CID 23556576
1,1-dibromo-1-(tribromomethylsulfonyl)butane (PubChem CID 23556576) has the molecular formula C5H7Br5O2S and a molecular weight of 530.70 g/mol. Its IUPAC name is 1,1-dibromo-1-(tribromomethylsulfonyl)butane.
| Compound Name | 1,1-dibromo-1-(tribromomethylsulfonyl)butane |
|---|---|
| PubChem CID | 23556576 |
| Molecular Formula | C5H7Br5O2S |
| Molecular Weight | 530.70 g/mol |
| Exact Mass | 525.61 |
| IUPAC Name | 1,1-dibromo-1-(tribromomethylsulfonyl)butane |
| SMILES | CCCC(Br)(Br)S(=O)(=O)C(Br)(Br)Br |
| InChI | InChI=1S/C5H7Br5O2S/c1-2-3-4(6,7)13(11,12)5(8,9)10/h2-3H2,1H3 |
| InChIKey | UDLWMBSEQGPLBL-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.70 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|