2-methylpentan-2-amine;sulfuric acid

C6H17NO4S — CID 174200327

IUPAC2-methylpentan-2-amine;sulfuric acid
SMILESCCCC(C)(C)N.O=S(=O)(O)O
InChIInChI=1S/C6H15N.H2O4S/c1-4-5-6(2,3)7;1-5(2,3)4/h4-5,7H2,1-3H3;(H2,1,2,3,4)
InChIKeyYEHKGOYLODOVLG-UHFFFAOYSA-N
MW199.27 g/mol
LogP0.87
Rot. Bonds2

About 2-methylpentan-2-amine;sulfuric acid

2-methylpentan-2-amine;sulfuric acid (PubChem CID 174200327) has the molecular formula C6H17NO4S and a molecular weight of 199.27 g/mol. Its IUPAC name is 2-methylpentan-2-amine;sulfuric acid.

Molecular Properties

Compound Name2-methylpentan-2-amine;sulfuric acid
PubChem CID174200327
Molecular FormulaC6H17NO4S
Molecular Weight199.27 g/mol
Exact Mass199.09
IUPAC Name2-methylpentan-2-amine;sulfuric acid
SMILESCCCC(C)(C)N.O=S(=O)(O)O
InChIInChI=1S/C6H15N.H2O4S/c1-4-5-6(2,3)7;1-5(2,3)4/h4-5,7H2,1-3H3;(H2,1,2,3,4)
InChIKeyYEHKGOYLODOVLG-UHFFFAOYSA-N
XLogP0.87
TPSA100.62 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.27
LogP ≤ 50.87
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-methylpentan-2-amine;sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methylpentan-2-amine;sulfuric acid?
The IUPAC name of 2-methylpentan-2-amine;sulfuric acid (CID 174200327) is 2-methylpentan-2-amine;sulfuric acid.
What is the SMILES notation for 2-methylpentan-2-amine;sulfuric acid?
The canonical SMILES for 2-methylpentan-2-amine;sulfuric acid is CCCC(C)(C)N.O=S(=O)(O)O.
What is the InChIKey of 2-methylpentan-2-amine;sulfuric acid?
The InChIKey is YEHKGOYLODOVLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.H2O4S/c1-4-5-6(2,3)7;1-5(2,3)4/h4-5,7H2,1-3H3;(H2,1,2,3,4).
What are the key properties of 2-methylpentan-2-amine;sulfuric acid?
2-methylpentan-2-amine;sulfuric acid has a molecular weight of 199.27 g/mol, XLogP of 0.87, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpentan-2-amine;sulfuric acid is sourced from PubChem (CID 174200327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).