C3H8CuO7S2 — CID 174846958
copper;1-hydroxypropane-1,1-disulfonic acid (PubChem CID 174846958) has the molecular formula C3H8CuO7S2 and a molecular weight of 283.77 g/mol. Its IUPAC name is copper;1-hydroxypropane-1,1-disulfonic acid.
| Compound Name | copper;1-hydroxypropane-1,1-disulfonic acid |
|---|---|
| PubChem CID | 174846958 |
| Molecular Formula | C3H8CuO7S2 |
| Molecular Weight | 283.77 g/mol |
| Exact Mass | 282.90 |
| IUPAC Name | copper;1-hydroxypropane-1,1-disulfonic acid |
| SMILES | CCC(O)(S(=O)(=O)O)S(=O)(=O)O.[Cu] |
| InChI | InChI=1S/C3H8O7S2.Cu/c1-2-3(4,11(5,6)7)12(8,9)10;/h4H,2H2,1H3,(H,5,6,7)(H,8,9,10); |
| InChIKey | QIIFAYUKHUABMP-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.77 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|