C11H23NO6S — CID 87169066
1-(dimethylamino)-1-hydroxypropane-1-sulfonic acid;ethyl 2-methylprop-2-enoate (PubChem CID 87169066) has the molecular formula C11H23NO6S and a molecular weight of 297.37 g/mol. Its IUPAC name is 1-(dimethylamino)-1-hydroxypropane-1-sulfonic acid;ethyl 2-methylprop-2-enoate.
| Compound Name | 1-(dimethylamino)-1-hydroxypropane-1-sulfonic acid;ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87169066 |
| Molecular Formula | C11H23NO6S |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 1-(dimethylamino)-1-hydroxypropane-1-sulfonic acid;ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC.CCC(O)(N(C)C)S(=O)(=O)O |
| InChI | InChI=1S/C6H10O2.C5H13NO4S/c1-4-8-6(7)5(2)3;1-4-5(7,6(2)3)11(8,9)10/h2,4H2,1,3H3;7H,4H2,1-3H3,(H,8,9,10) |
| InChIKey | IKVQDCHIHBIAID-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|