C18H10ClF8N7OS — CID 135326171
5-chloro-N-(1-cyanocyclopropyl)-2-[1-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]pyrazol-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 135326171) has the molecular formula C18H10ClF8N7OS and a molecular weight of 559.83 g/mol. Its IUPAC name is 5-chloro-N-(1-cyanocyclopropyl)-2-[1-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]pyrazol-4-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | 5-chloro-N-(1-cyanocyclopropyl)-2-[1-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]pyrazol-4-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 135326171 |
| Molecular Formula | C18H10ClF8N7OS |
| Molecular Weight | 559.83 g/mol |
| Exact Mass | 559.02 |
| IUPAC Name | 5-chloro-N-(1-cyanocyclopropyl)-2-[1-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]pyrazol-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | Cn1nc(C(F)(F)C(F)(F)F)c(C(F)(F)F)c1-n1cc(-c2nc(C(=O)NC3(C#N)CC3)c(Cl)s2)cn1 |
| InChI | InChI=1S/C18H10ClF8N7OS/c1-33-14(8(17(22,23)24)10(32-33)16(20,21)18(25,26)27)34-5-7(4-29-34)13-30-9(11(19)36-13)12(35)31-15(6-28)2-3-15/h4-5H,2-3H2,1H3,(H,31,35) |
| InChIKey | QKAOOEUUWNBQIZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 101.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.83 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|