C22H20Cl2N6O2 — CID 135328722
5,8-dichloro-7-(3,5-dimethyltriazol-4-yl)-2-[(7-methyl-5-oxo-1,6-dihydropyrrolo[2,3-c]pyridin-4-yl)methyl]-3,4-dihydroisoquinolin-1-one (PubChem CID 135328722) has the molecular formula C22H20Cl2N6O2 and a molecular weight of 471.35 g/mol. Its IUPAC name is 5,8-dichloro-7-(3,5-dimethyltriazol-4-yl)-2-[(7-methyl-5-oxo-1,6-dihydropyrrolo[2,3-c]pyridin-4-yl)methyl]-3,4-dihydroisoquinolin-1-one.
| Compound Name | 5,8-dichloro-7-(3,5-dimethyltriazol-4-yl)-2-[(7-methyl-5-oxo-1,6-dihydropyrrolo[2,3-c]pyridin-4-yl)methyl]-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 135328722 |
| Molecular Formula | C22H20Cl2N6O2 |
| Molecular Weight | 471.35 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | 5,8-dichloro-7-(3,5-dimethyltriazol-4-yl)-2-[(7-methyl-5-oxo-1,6-dihydropyrrolo[2,3-c]pyridin-4-yl)methyl]-3,4-dihydroisoquinolin-1-one |
| SMILES | Cc1nnn(C)c1-c1cc(Cl)c2c(c1Cl)C(=O)N(Cc1c(=O)[nH]c(C)c3[nH]ccc13)CC2 |
| InChI | InChI=1S/C22H20Cl2N6O2/c1-10-19-12(4-6-25-19)15(21(31)26-10)9-30-7-5-13-16(23)8-14(18(24)17(13)22(30)32)20-11(2)27-28-29(20)3/h4,6,8,25H,5,7,9H2,1-3H3,(H,26,31) |
| InChIKey | XZUBQBJEILVKEL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 99.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |