C13H14ClN5O — CID 86723829
5-amino-8-chloro-7-(3,5-dimethyltriazol-4-yl)-3,4-dihydro-2H-isoquinolin-1-one (PubChem CID 86723829) has the molecular formula C13H14ClN5O and a molecular weight of 291.74 g/mol. Its IUPAC name is 5-amino-8-chloro-7-(3,5-dimethyltriazol-4-yl)-3,4-dihydro-2H-isoquinolin-1-one.
| Compound Name | 5-amino-8-chloro-7-(3,5-dimethyltriazol-4-yl)-3,4-dihydro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 86723829 |
| Molecular Formula | C13H14ClN5O |
| Molecular Weight | 291.74 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 5-amino-8-chloro-7-(3,5-dimethyltriazol-4-yl)-3,4-dihydro-2H-isoquinolin-1-one |
| SMILES | Cc1nnn(C)c1-c1cc(N)c2c(c1Cl)C(=O)NCC2 |
| InChI | InChI=1S/C13H14ClN5O/c1-6-12(19(2)18-17-6)8-5-9(15)7-3-4-16-13(20)10(7)11(8)14/h5H,3-4,15H2,1-2H3,(H,16,20) |
| InChIKey | RLADEACUWMVDRG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.74 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|