About 2-[(8-heptadecan-9-yloxy-8-oxooctyl)amino]ethyl 4-hydroxybenzoate
2-[(8-heptadecan-9-yloxy-8-oxooctyl)amino]ethyl 4-hydroxybenzoate (PubChem CID 135329571) has the molecular formula C34H59NO5
and a molecular weight of 561.85 g/mol. Its IUPAC name is 2-[(8-heptadecan-9-yloxy-8-oxooctyl)amino]ethyl 4-hydroxybenzoate.
Molecular Properties
| Compound Name | 2-[(8-heptadecan-9-yloxy-8-oxooctyl)amino]ethyl 4-hydroxybenzoate |
| PubChem CID | 135329571 |
| Molecular Formula | C34H59NO5 |
| Molecular Weight | 561.85 g/mol |
| Exact Mass | 561.44 |
| IUPAC Name | 2-[(8-heptadecan-9-yloxy-8-oxooctyl)amino]ethyl 4-hydroxybenzoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCNCCOC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C34H59NO5/c1-3-5-7-9-12-16-20-32(21-17-13-10-8-6-4-2)40-33(37)22-18-14-11-15-19-27-35-28-29-39-34(38)30-23-25-31(36)26-24-30/h23-26,32,35-36H,3-22,27-29H2,1-2H3 |
| InChIKey | KAEBXKKEHXXFIZ-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 561.85 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(8-heptadecan-9-yloxy-8-oxooctyl)amino]ethyl 4-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(8-heptadecan-9-yloxy-8-oxooctyl)amino]ethyl 4-hydroxybenzoate?
The IUPAC name of 2-[(8-heptadecan-9-yloxy-8-oxooctyl)amino]ethyl 4-hydroxybenzoate (CID 135329571) is 2-[(8-heptadecan-9-yloxy-8-oxooctyl)amino]ethyl 4-hydroxybenzoate.
What is the SMILES notation for 2-[(8-heptadecan-9-yloxy-8-oxooctyl)amino]ethyl 4-hydroxybenzoate?
The canonical SMILES for 2-[(8-heptadecan-9-yloxy-8-oxooctyl)amino]ethyl 4-hydroxybenzoate is CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCNCCOC(=O)c1ccc(O)cc1.
What is the InChIKey of 2-[(8-heptadecan-9-yloxy-8-oxooctyl)amino]ethyl 4-hydroxybenzoate?
The InChIKey is KAEBXKKEHXXFIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H59NO5/c1-3-5-7-9-12-16-20-32(21-17-13-10-8-6-4-2)40-33(37)22-18-14-11-15-19-27-35-28-29-39-34(38)30-23-25-31(36)26-24-30/h23-26,32,35-36H,3-22,27-29H2,1-2H3.
What are the key properties of 2-[(8-heptadecan-9-yloxy-8-oxooctyl)amino]ethyl 4-hydroxybenzoate?
2-[(8-heptadecan-9-yloxy-8-oxooctyl)amino]ethyl 4-hydroxybenzoate has a molecular weight of 561.85 g/mol, XLogP of 8.89, 27 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(8-heptadecan-9-yloxy-8-oxooctyl)amino]ethyl 4-hydroxybenzoate is sourced from PubChem (CID 135329571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).