C11H19FN2O4 — CID 135331197
5-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carboxylic acid (PubChem CID 135331197) has the molecular formula C11H19FN2O4 and a molecular weight of 262.28 g/mol. Its IUPAC name is 5-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carboxylic acid.
| Compound Name | 5-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 135331197 |
| Molecular Formula | C11H19FN2O4 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 5-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)NC1CCC(F)CN1C(=O)O |
| InChI | InChI=1S/C11H19FN2O4/c1-11(2,3)18-9(15)13-8-5-4-7(12)6-14(8)10(16)17/h7-8H,4-6H2,1-3H3,(H,13,15)(H,16,17) |
| InChIKey | ZITGQAIUIYUHHZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |