C26H30N4O4 — CID 135332619
1-[[3-(2-methoxyethoxy)phenyl]methyl]-4-(5-morpholin-4-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)-2H-pyridin-2-ol (PubChem CID 135332619) has the molecular formula C26H30N4O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is 1-[[3-(2-methoxyethoxy)phenyl]methyl]-4-(5-morpholin-4-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)-2H-pyridin-2-ol.
| Compound Name | 1-[[3-(2-methoxyethoxy)phenyl]methyl]-4-(5-morpholin-4-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)-2H-pyridin-2-ol |
|---|---|
| PubChem CID | 135332619 |
| Molecular Formula | C26H30N4O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 1-[[3-(2-methoxyethoxy)phenyl]methyl]-4-(5-morpholin-4-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)-2H-pyridin-2-ol |
| SMILES | COCCOc1cccc(CN2C=CC(c3c[nH]c4ncc(N5CCOCC5)cc34)=CC2O)c1 |
| InChI | InChI=1S/C26H30N4O4/c1-32-11-12-34-22-4-2-3-19(13-22)18-30-6-5-20(14-25(30)31)24-17-28-26-23(24)15-21(16-27-26)29-7-9-33-10-8-29/h2-6,13-17,25,31H,7-12,18H2,1H3,(H,27,28) |
| InChIKey | PGKVAHBLEFPJCL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 83.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|