C26H27ClN4O3 — CID 135332467
1-[(3-chloro-5-propan-2-yloxyphenyl)methyl]-4-(5-morpholin-4-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-one (PubChem CID 135332467) has the molecular formula C26H27ClN4O3 and a molecular weight of 478.98 g/mol. Its IUPAC name is 1-[(3-chloro-5-propan-2-yloxyphenyl)methyl]-4-(5-morpholin-4-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-one.
| Compound Name | 1-[(3-chloro-5-propan-2-yloxyphenyl)methyl]-4-(5-morpholin-4-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-one |
|---|---|
| PubChem CID | 135332467 |
| Molecular Formula | C26H27ClN4O3 |
| Molecular Weight | 478.98 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 1-[(3-chloro-5-propan-2-yloxyphenyl)methyl]-4-(5-morpholin-4-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-one |
| SMILES | CC(C)Oc1cc(Cl)cc(Cn2ccc(-c3c[nH]c4ncc(N5CCOCC5)cc34)cc2=O)c1 |
| InChI | InChI=1S/C26H27ClN4O3/c1-17(2)34-22-10-18(9-20(27)12-22)16-31-4-3-19(11-25(31)32)24-15-29-26-23(24)13-21(14-28-26)30-5-7-33-8-6-30/h3-4,9-15,17H,5-8,16H2,1-2H3,(H,28,29) |
| InChIKey | MOKRHTIKUJEOPE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 72.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.98 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|