C22H20ClN5O2 — CID 129163182
1-[(3-chlorophenyl)methyl]-4-(2-morpholin-4-yl-5H-pyrrolo[2,3-b]pyrazin-7-yl)pyridin-2-one (PubChem CID 129163182) has the molecular formula C22H20ClN5O2 and a molecular weight of 421.89 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-4-(2-morpholin-4-yl-5H-pyrrolo[2,3-b]pyrazin-7-yl)pyridin-2-one.
| Compound Name | 1-[(3-chlorophenyl)methyl]-4-(2-morpholin-4-yl-5H-pyrrolo[2,3-b]pyrazin-7-yl)pyridin-2-one |
|---|---|
| PubChem CID | 129163182 |
| Molecular Formula | C22H20ClN5O2 |
| Molecular Weight | 421.89 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-4-(2-morpholin-4-yl-5H-pyrrolo[2,3-b]pyrazin-7-yl)pyridin-2-one |
| SMILES | O=c1cc(-c2c[nH]c3ncc(N4CCOCC4)nc23)ccn1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H20ClN5O2/c23-17-3-1-2-15(10-17)14-28-5-4-16(11-20(28)29)18-12-24-22-21(18)26-19(13-25-22)27-6-8-30-9-7-27/h1-5,10-13H,6-9,14H2,(H,24,25) |
| InChIKey | DHDKRGUWQOABNO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.89 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|