C24H22IN3O2 — CID 157089905
1-[(3-iodophenyl)methyl]-4-(3-morpholin-4-yl-7H-cyclopenta[b]pyridin-5-yl)pyridin-2-one (PubChem CID 157089905) has the molecular formula C24H22IN3O2 and a molecular weight of 511.36 g/mol. Its IUPAC name is 1-[(3-iodophenyl)methyl]-4-(3-morpholin-4-yl-7H-cyclopenta[b]pyridin-5-yl)pyridin-2-one.
| Compound Name | 1-[(3-iodophenyl)methyl]-4-(3-morpholin-4-yl-7H-cyclopenta[b]pyridin-5-yl)pyridin-2-one |
|---|---|
| PubChem CID | 157089905 |
| Molecular Formula | C24H22IN3O2 |
| Molecular Weight | 511.36 g/mol |
| Exact Mass | 511.08 |
| IUPAC Name | 1-[(3-iodophenyl)methyl]-4-(3-morpholin-4-yl-7H-cyclopenta[b]pyridin-5-yl)pyridin-2-one |
| SMILES | O=c1cc(C2=CCc3ncc(N4CCOCC4)cc32)ccn1Cc1cccc(I)c1 |
| InChI | InChI=1S/C24H22IN3O2/c25-19-3-1-2-17(12-19)16-28-7-6-18(13-24(28)29)21-4-5-23-22(21)14-20(15-26-23)27-8-10-30-11-9-27/h1-4,6-7,12-15H,5,8-11,16H2 |
| InChIKey | AENUBLWMJOAYRJ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.36 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|