C26H29FN4O2S — CID 145311908
ethane;1-[(4-fluoro-3-methylphenyl)methyl]-4-(5-morpholin-4-yl-1-sulfanylpyrrolo[2,3-b]pyridin-3-yl)pyridin-2-one (PubChem CID 145311908) has the molecular formula C26H29FN4O2S and a molecular weight of 480.61 g/mol. Its IUPAC name is ethane;1-[(4-fluoro-3-methylphenyl)methyl]-4-(5-morpholin-4-yl-1-sulfanylpyrrolo[2,3-b]pyridin-3-yl)pyridin-2-one.
| Compound Name | ethane;1-[(4-fluoro-3-methylphenyl)methyl]-4-(5-morpholin-4-yl-1-sulfanylpyrrolo[2,3-b]pyridin-3-yl)pyridin-2-one |
|---|---|
| PubChem CID | 145311908 |
| Molecular Formula | C26H29FN4O2S |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | ethane;1-[(4-fluoro-3-methylphenyl)methyl]-4-(5-morpholin-4-yl-1-sulfanylpyrrolo[2,3-b]pyridin-3-yl)pyridin-2-one |
| SMILES | CC.Cc1cc(Cn2ccc(-c3cn(S)c4ncc(N5CCOCC5)cc34)cc2=O)ccc1F |
| InChI | InChI=1S/C24H23FN4O2S.C2H6/c1-16-10-17(2-3-22(16)25)14-28-5-4-18(11-23(28)30)21-15-29(32)24-20(21)12-19(13-26-24)27-6-8-31-9-7-27;1-2/h2-5,10-13,15,32H,6-9,14H2,1H3;1-2H3 |
| InChIKey | VSTHSQAGIZVBIY-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 52.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|