C23H21ClN4O2S — CID 145311929
1-[(4-chlorophenyl)methyl]-4-(5-morpholin-4-yl-1-sulfanylpyrrolo[2,3-b]pyridin-3-yl)pyridin-2-one (PubChem CID 145311929) has the molecular formula C23H21ClN4O2S and a molecular weight of 452.97 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-4-(5-morpholin-4-yl-1-sulfanylpyrrolo[2,3-b]pyridin-3-yl)pyridin-2-one.
| Compound Name | 1-[(4-chlorophenyl)methyl]-4-(5-morpholin-4-yl-1-sulfanylpyrrolo[2,3-b]pyridin-3-yl)pyridin-2-one |
|---|---|
| PubChem CID | 145311929 |
| Molecular Formula | C23H21ClN4O2S |
| Molecular Weight | 452.97 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-4-(5-morpholin-4-yl-1-sulfanylpyrrolo[2,3-b]pyridin-3-yl)pyridin-2-one |
| SMILES | O=c1cc(-c2cn(S)c3ncc(N4CCOCC4)cc23)ccn1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H21ClN4O2S/c24-18-3-1-16(2-4-18)14-27-6-5-17(11-22(27)29)21-15-28(31)23-20(21)12-19(13-25-23)26-7-9-30-10-8-26/h1-6,11-13,15,31H,7-10,14H2 |
| InChIKey | SUSIDOPRJIXBCC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 52.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.97 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|