C24H24ClN4O6P — CID 135332484
[3-[1-[(3-chlorophenyl)methyl]-2-oxo-4-pyridinyl]-5-morpholin-4-ylpyrrolo[2,3-b]pyridin-1-yl]methyl dihydrogen phosphate (PubChem CID 135332484) has the molecular formula C24H24ClN4O6P and a molecular weight of 530.91 g/mol. Its IUPAC name is [3-[1-[(3-chlorophenyl)methyl]-2-oxo-4-pyridinyl]-5-morpholin-4-ylpyrrolo[2,3-b]pyridin-1-yl]methyl dihydrogen phosphate.
| Compound Name | [3-[1-[(3-chlorophenyl)methyl]-2-oxo-4-pyridinyl]-5-morpholin-4-ylpyrrolo[2,3-b]pyridin-1-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 135332484 |
| Molecular Formula | C24H24ClN4O6P |
| Molecular Weight | 530.91 g/mol |
| Exact Mass | 530.11 |
| IUPAC Name | [3-[1-[(3-chlorophenyl)methyl]-2-oxo-4-pyridinyl]-5-morpholin-4-ylpyrrolo[2,3-b]pyridin-1-yl]methyl dihydrogen phosphate |
| SMILES | O=c1cc(-c2cn(COP(=O)(O)O)c3ncc(N4CCOCC4)cc23)ccn1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C24H24ClN4O6P/c25-19-3-1-2-17(10-19)14-28-5-4-18(11-23(28)30)22-15-29(16-35-36(31,32)33)24-21(22)12-20(13-26-24)27-6-8-34-9-7-27/h1-5,10-13,15H,6-9,14,16H2,(H2,31,32,33) |
| InChIKey | LMRGVPUQYZSEST-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.91 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|