C23H20Cl2N4OS2 — CID 145311925
1-[(3,4-dichlorophenyl)methyl]-4-(1-sulfanyl-5-thiomorpholin-4-ylpyrrolo[2,3-b]pyridin-3-yl)pyridin-2-one (PubChem CID 145311925) has the molecular formula C23H20Cl2N4OS2 and a molecular weight of 503.48 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-4-(1-sulfanyl-5-thiomorpholin-4-ylpyrrolo[2,3-b]pyridin-3-yl)pyridin-2-one.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-4-(1-sulfanyl-5-thiomorpholin-4-ylpyrrolo[2,3-b]pyridin-3-yl)pyridin-2-one |
|---|---|
| PubChem CID | 145311925 |
| Molecular Formula | C23H20Cl2N4OS2 |
| Molecular Weight | 503.48 g/mol |
| Exact Mass | 502.05 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-4-(1-sulfanyl-5-thiomorpholin-4-ylpyrrolo[2,3-b]pyridin-3-yl)pyridin-2-one |
| SMILES | O=c1cc(-c2cn(S)c3ncc(N4CCSCC4)cc23)ccn1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H20Cl2N4OS2/c24-20-2-1-15(9-21(20)25)13-28-4-3-16(10-22(28)30)19-14-29(31)23-18(19)11-17(12-26-23)27-5-7-32-8-6-27/h1-4,9-12,14,31H,5-8,13H2 |
| InChIKey | HTFHGMYIMVJJFX-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 43.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.48 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|