C30H25F3N4O4S — CID 135332455
4-[1-(4-methylphenyl)sulfonyl-5-morpholin-4-ylpyrrolo[2,3-b]pyridin-3-yl]-1-[(2,3,4-trifluorophenyl)methyl]pyridin-2-one (PubChem CID 135332455) has the molecular formula C30H25F3N4O4S and a molecular weight of 594.62 g/mol. Its IUPAC name is 4-[1-(4-methylphenyl)sulfonyl-5-morpholin-4-ylpyrrolo[2,3-b]pyridin-3-yl]-1-[(2,3,4-trifluorophenyl)methyl]pyridin-2-one.
| Compound Name | 4-[1-(4-methylphenyl)sulfonyl-5-morpholin-4-ylpyrrolo[2,3-b]pyridin-3-yl]-1-[(2,3,4-trifluorophenyl)methyl]pyridin-2-one |
|---|---|
| PubChem CID | 135332455 |
| Molecular Formula | C30H25F3N4O4S |
| Molecular Weight | 594.62 g/mol |
| Exact Mass | 594.15 |
| IUPAC Name | 4-[1-(4-methylphenyl)sulfonyl-5-morpholin-4-ylpyrrolo[2,3-b]pyridin-3-yl]-1-[(2,3,4-trifluorophenyl)methyl]pyridin-2-one |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(-c3ccn(Cc4ccc(F)c(F)c4F)c(=O)c3)c3cc(N4CCOCC4)cnc32)cc1 |
| InChI | InChI=1S/C30H25F3N4O4S/c1-19-2-5-23(6-3-19)42(39,40)37-18-25(24-15-22(16-34-30(24)37)35-10-12-41-13-11-35)20-8-9-36(27(38)14-20)17-21-4-7-26(31)29(33)28(21)32/h2-9,14-16,18H,10-13,17H2,1H3 |
| InChIKey | YUHRNTYBVQEEKA-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 86.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.62 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|