C27H29FN4O4 — CID 135333191
2-butoxy-4-[6-[2-(6-fluoro-4-methoxy-2-methylindol-1-yl)ethylamino]pyrimidin-4-yl]benzoic acid (PubChem CID 135333191) has the molecular formula C27H29FN4O4 and a molecular weight of 492.55 g/mol. Its IUPAC name is 2-butoxy-4-[6-[2-(6-fluoro-4-methoxy-2-methylindol-1-yl)ethylamino]pyrimidin-4-yl]benzoic acid.
| Compound Name | 2-butoxy-4-[6-[2-(6-fluoro-4-methoxy-2-methylindol-1-yl)ethylamino]pyrimidin-4-yl]benzoic acid |
|---|---|
| PubChem CID | 135333191 |
| Molecular Formula | C27H29FN4O4 |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | 2-butoxy-4-[6-[2-(6-fluoro-4-methoxy-2-methylindol-1-yl)ethylamino]pyrimidin-4-yl]benzoic acid |
| SMILES | CCCCOc1cc(-c2cc(NCCn3c(C)cc4c(OC)cc(F)cc43)ncn2)ccc1C(=O)O |
| InChI | InChI=1S/C27H29FN4O4/c1-4-5-10-36-25-12-18(6-7-20(25)27(33)34)22-15-26(31-16-30-22)29-8-9-32-17(2)11-21-23(32)13-19(28)14-24(21)35-3/h6-7,11-16H,4-5,8-10H2,1-3H3,(H,33,34)(H,29,30,31) |
| InChIKey | LSDHKKJFFFOXFD-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|