C24H21F3N4O3 — CID 135333598
2-ethoxy-4-[6-[2-(4,5,7-trifluoro-2-methylindol-1-yl)ethylamino]pyrimidin-4-yl]benzoic acid (PubChem CID 135333598) has the molecular formula C24H21F3N4O3 and a molecular weight of 470.45 g/mol. Its IUPAC name is 2-ethoxy-4-[6-[2-(4,5,7-trifluoro-2-methylindol-1-yl)ethylamino]pyrimidin-4-yl]benzoic acid.
| Compound Name | 2-ethoxy-4-[6-[2-(4,5,7-trifluoro-2-methylindol-1-yl)ethylamino]pyrimidin-4-yl]benzoic acid |
|---|---|
| PubChem CID | 135333598 |
| Molecular Formula | C24H21F3N4O3 |
| Molecular Weight | 470.45 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | 2-ethoxy-4-[6-[2-(4,5,7-trifluoro-2-methylindol-1-yl)ethylamino]pyrimidin-4-yl]benzoic acid |
| SMILES | CCOc1cc(-c2cc(NCCn3c(C)cc4c(F)c(F)cc(F)c43)ncn2)ccc1C(=O)O |
| InChI | InChI=1S/C24H21F3N4O3/c1-3-34-20-9-14(4-5-15(20)24(32)33)19-11-21(30-12-29-19)28-6-7-31-13(2)8-16-22(27)17(25)10-18(26)23(16)31/h4-5,8-12H,3,6-7H2,1-2H3,(H,32,33)(H,28,29,30) |
| InChIKey | LLJHEIXEJRAAPY-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.45 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|